C11H20BClN2O3 — CID 131697685
(6-amino-3-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid;hydrochloride (PubChem CID 131697685) has the molecular formula C11H20BClN2O3 and a molecular weight of 274.56 g/mol. Its IUPAC name is (6-amino-3-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid;hydrochloride.
| Compound Name | (6-amino-3-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid;hydrochloride |
|---|---|
| PubChem CID | 131697685 |
| Molecular Formula | C11H20BClN2O3 |
| Molecular Weight | 274.56 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (6-amino-3-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid;hydrochloride |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1ccc(N)nc1.Cl |
| InChI | InChI=1S/C11H19BN2O3.ClH/c1-10(2,15)11(3,4)17-12(16)8-5-6-9(13)14-7-8;/h5-7,15-16H,1-4H3,(H2,13,14);1H |
| InChIKey | VTJUNDKQQYPPLS-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.56 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|