C23H21F4IO6S — CID 131697918
[4-fluoro-3-(trifluoromethyl)phenyl]-(2,4,6-trimethoxyphenyl)iodanium;4-methylbenzenesulfonate (PubChem CID 131697918) has the molecular formula C23H21F4IO6S and a molecular weight of 628.38 g/mol. Its IUPAC name is [4-fluoro-3-(trifluoromethyl)phenyl]-(2,4,6-trimethoxyphenyl)iodanium;4-methylbenzenesulfonate.
| Compound Name | [4-fluoro-3-(trifluoromethyl)phenyl]-(2,4,6-trimethoxyphenyl)iodanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 131697918 |
| Molecular Formula | C23H21F4IO6S |
| Molecular Weight | 628.38 g/mol |
| Exact Mass | 628.00 |
| IUPAC Name | [4-fluoro-3-(trifluoromethyl)phenyl]-(2,4,6-trimethoxyphenyl)iodanium;4-methylbenzenesulfonate |
| SMILES | COc1cc(OC)c([I+]c2ccc(F)c(C(F)(F)F)c2)c(OC)c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C16H14F4IO3.C7H8O3S/c1-22-10-7-13(23-2)15(14(8-10)24-3)21-9-4-5-12(17)11(6-9)16(18,19)20;1-6-2-4-7(5-3-6)11(8,9)10/h4-8H,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | JRLOQNMMXUNDFI-UHFFFAOYSA-M |
| XLogP | 1.90 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|