About 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium
4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium (PubChem CID 131697920) has the molecular formula C22H23IO6S
and a molecular weight of 542.39 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium |
| PubChem CID | 131697920 |
| Molecular Formula | C22H23IO6S |
| Molecular Weight | 542.39 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium |
| SMILES | COc1cc(OC)c([I+]c2ccccc2)c(OC)c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C15H16IO3.C7H8O3S/c1-17-12-9-13(18-2)15(14(10-12)19-3)16-11-7-5-4-6-8-11;1-6-2-4-7(5-3-6)11(8,9)10/h4-10H,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | GGEMRLZODUITOC-UHFFFAOYSA-M |
| XLogP | 0.74 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 542.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium?
The IUPAC name of 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium (CID 131697920) is 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium.
What is the SMILES notation for 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium?
The canonical SMILES for 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium is COc1cc(OC)c([I+]c2ccccc2)c(OC)c1.Cc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium?
The InChIKey is GGEMRLZODUITOC-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H16IO3.C7H8O3S/c1-17-12-9-13(18-2)15(14(10-12)19-3)16-11-7-5-4-6-8-11;1-6-2-4-7(5-3-6)11(8,9)10/h4-10H,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1.
What are the key properties of 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium?
4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium has a molecular weight of 542.39 g/mol, XLogP of 0.74, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonate;phenyl-(2,4,6-trimethoxyphenyl)iodanium is sourced from PubChem (CID 131697920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).