C9H7NO4 — CID 131698490
(3S)-3-amino-3,4-dihydrochromene-2,6,7-trione (PubChem CID 131698490) has the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. Its IUPAC name is (3S)-3-amino-3,4-dihydrochromene-2,6,7-trione.
| Compound Name | (3S)-3-amino-3,4-dihydrochromene-2,6,7-trione |
|---|---|
| PubChem CID | 131698490 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | (3S)-3-amino-3,4-dihydrochromene-2,6,7-trione |
| SMILES | N[C@H]1CC2=CC(=O)C(=O)C=C2OC1=O |
| InChI | InChI=1S/C9H7NO4/c10-5-1-4-2-6(11)7(12)3-8(4)14-9(5)13/h2-3,5H,1,10H2/t5-/m0/s1 |
| InChIKey | RZTGZIWOVGOFDC-YFKPBYRVSA-N |
| XLogP | -0.78 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|