C14H19NO6S2 — CID 131699282
3-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)propane-1-sulfonate (PubChem CID 131699282) has the molecular formula C14H19NO6S2 and a molecular weight of 361.44 g/mol. Its IUPAC name is 3-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)propane-1-sulfonate.
| Compound Name | 3-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)propane-1-sulfonate |
|---|---|
| PubChem CID | 131699282 |
| Molecular Formula | C14H19NO6S2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 3-(2,3,3-trimethyl-5-sulfoindol-1-ium-1-yl)propane-1-sulfonate |
| SMILES | CC1=[N+](CCCS(=O)(=O)[O-])c2ccc(S(=O)(=O)O)cc2C1(C)C |
| InChI | InChI=1S/C14H19NO6S2/c1-10-14(2,3)12-9-11(23(19,20)21)5-6-13(12)15(10)7-4-8-22(16,17)18/h5-6,9H,4,7-8H2,1-3H3,(H-,16,17,18,19,20,21) |
| InChIKey | IJNKOCJUWUUMCV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|