C11H10N4 — CID 131699298
7,8,9-trideuterio-3-methylimidazo[4,5-f]quinolin-2-amine (PubChem CID 131699298) has the molecular formula C11H10N4 and a molecular weight of 201.25 g/mol. Its IUPAC name is 7,8,9-trideuterio-3-methylimidazo[4,5-f]quinolin-2-amine.
| Compound Name | 7,8,9-trideuterio-3-methylimidazo[4,5-f]quinolin-2-amine |
|---|---|
| PubChem CID | 131699298 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 7,8,9-trideuterio-3-methylimidazo[4,5-f]quinolin-2-amine |
| SMILES | [2H]c1nc2ccc3c(nc(N)n3C)c2c([2H])c1[2H] |
| InChI | InChI=1S/C11H10N4/c1-15-9-5-4-8-7(3-2-6-13-8)10(9)14-11(15)12/h2-6H,1H3,(H2,12,14)/i2D,3D,6D |
| InChIKey | ARZWATDYIYAUTA-WQNTXASMSA-N |
| XLogP | 1.70 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |