About 8-fluoropyrido[4,3-d]pyrimidin-4-amine
8-fluoropyrido[4,3-d]pyrimidin-4-amine (PubChem CID 131699662) has the molecular formula C7H5FN4
and a molecular weight of 164.14 g/mol. Its IUPAC name is 8-fluoropyrido[4,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 8-fluoropyrido[4,3-d]pyrimidin-4-amine |
| PubChem CID | 131699662 |
| Molecular Formula | C7H5FN4 |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 8-fluoropyrido[4,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c(F)cncc12 |
| InChI | InChI=1S/C7H5FN4/c8-5-2-10-1-4-6(5)11-3-12-7(4)9/h1-3H,(H2,9,11,12) |
| InChIKey | UCJXBNHCQRTWHI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-fluoropyrido[4,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoropyrido[4,3-d]pyrimidin-4-amine?
The IUPAC name of 8-fluoropyrido[4,3-d]pyrimidin-4-amine (CID 131699662) is 8-fluoropyrido[4,3-d]pyrimidin-4-amine.
What is the SMILES notation for 8-fluoropyrido[4,3-d]pyrimidin-4-amine?
The canonical SMILES for 8-fluoropyrido[4,3-d]pyrimidin-4-amine is Nc1ncnc2c(F)cncc12.
What is the InChIKey of 8-fluoropyrido[4,3-d]pyrimidin-4-amine?
The InChIKey is UCJXBNHCQRTWHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FN4/c8-5-2-10-1-4-6(5)11-3-12-7(4)9/h1-3H,(H2,9,11,12).
What are the key properties of 8-fluoropyrido[4,3-d]pyrimidin-4-amine?
8-fluoropyrido[4,3-d]pyrimidin-4-amine has a molecular weight of 164.14 g/mol, XLogP of 0.75, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoropyrido[4,3-d]pyrimidin-4-amine is sourced from PubChem (CID 131699662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).