C10H9NO2 — CID 131700013
5-methyl-1H-quinoline-2,4-dione (PubChem CID 131700013) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 5-methyl-1H-quinoline-2,4-dione.
| Compound Name | 5-methyl-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 131700013 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 5-methyl-1H-quinoline-2,4-dione |
| SMILES | Cc1cccc2c1C(=O)CC(=O)N2 |
| InChI | InChI=1S/C10H9NO2/c1-6-3-2-4-7-10(6)8(12)5-9(13)11-7/h2-4H,5H2,1H3,(H,11,13) |
| InChIKey | SERLBGBMESPVNT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|