About (1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate
(1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate (PubChem CID 131700074) has the molecular formula C16H22O5
and a molecular weight of 294.35 g/mol. Its IUPAC name is (1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate.
Molecular Properties
| Compound Name | (1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate |
| PubChem CID | 131700074 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate |
| SMILES | CCCCC(=O)C1=CC(CC)(OC(C)=O)C(=O)C(C)=C1O |
| InChI | InChI=1S/C16H22O5/c1-5-7-8-13(18)12-9-16(6-2,21-11(4)17)15(20)10(3)14(12)19/h9,19H,5-8H2,1-4H3 |
| InChIKey | JVHLJJPPSPMWFC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate?
The IUPAC name of (1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate (CID 131700074) is (1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate.
What is the SMILES notation for (1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate?
The canonical SMILES for (1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate is CCCCC(=O)C1=CC(CC)(OC(C)=O)C(=O)C(C)=C1O.
What is the InChIKey of (1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate?
The InChIKey is JVHLJJPPSPMWFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O5/c1-5-7-8-13(18)12-9-16(6-2,21-11(4)17)15(20)10(3)14(12)19/h9,19H,5-8H2,1-4H3.
What are the key properties of (1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate?
(1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate has a molecular weight of 294.35 g/mol, XLogP of 2.80, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethyl-4-hydroxy-5-methyl-6-oxo-3-pentanoylcyclohexa-2,4-dien-1-yl) acetate is sourced from PubChem (CID 131700074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).