About 2-bromo-1,3,5-trideuterio-4-methylbenzene
2-bromo-1,3,5-trideuterio-4-methylbenzene (PubChem CID 131701141) has the molecular formula C7H7Br
and a molecular weight of 174.06 g/mol. Its IUPAC name is 2-bromo-1,3,5-trideuterio-4-methylbenzene.
Molecular Properties
| Compound Name | 2-bromo-1,3,5-trideuterio-4-methylbenzene |
| PubChem CID | 131701141 |
| Molecular Formula | C7H7Br |
| Molecular Weight | 174.06 g/mol |
| Exact Mass | 172.99 |
| IUPAC Name | 2-bromo-1,3,5-trideuterio-4-methylbenzene |
| SMILES | [2H]c1cc([2H])c(Br)c([2H])c1C |
| InChI | InChI=1S/C7H7Br/c1-6-3-2-4-7(8)5-6/h2-5H,1H3/i3D,4D,5D |
| InChIKey | WJIFKOVZNJTSGO-QGZYMEECSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.06 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-bromo-1,3,5-trideuterio-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,3,5-trideuterio-4-methylbenzene?
The IUPAC name of 2-bromo-1,3,5-trideuterio-4-methylbenzene (CID 131701141) is 2-bromo-1,3,5-trideuterio-4-methylbenzene.
What is the SMILES notation for 2-bromo-1,3,5-trideuterio-4-methylbenzene?
The canonical SMILES for 2-bromo-1,3,5-trideuterio-4-methylbenzene is [2H]c1cc([2H])c(Br)c([2H])c1C.
What is the InChIKey of 2-bromo-1,3,5-trideuterio-4-methylbenzene?
The InChIKey is WJIFKOVZNJTSGO-QGZYMEECSA-N. The full InChI is InChI=1S/C7H7Br/c1-6-3-2-4-7(8)5-6/h2-5H,1H3/i3D,4D,5D.
What are the key properties of 2-bromo-1,3,5-trideuterio-4-methylbenzene?
2-bromo-1,3,5-trideuterio-4-methylbenzene has a molecular weight of 174.06 g/mol, XLogP of 2.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,3,5-trideuterio-4-methylbenzene is sourced from PubChem (CID 131701141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).