C13H19NO4 — CID 13170127
(4E,9E)-7-nitrotrideca-4,9-diene-2,12-dione (PubChem CID 13170127) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is (4E,9E)-7-nitrotrideca-4,9-diene-2,12-dione.
| Compound Name | (4E,9E)-7-nitrotrideca-4,9-diene-2,12-dione |
|---|---|
| PubChem CID | 13170127 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (4E,9E)-7-nitrotrideca-4,9-diene-2,12-dione |
| SMILES | CC(=O)C/C=C/CC(C/C=C/CC(C)=O)[N+](=O)[O-] |
| InChI | InChI=1S/C13H19NO4/c1-11(15)7-3-5-9-13(14(17)18)10-6-4-8-12(2)16/h3-6,13H,7-10H2,1-2H3/b5-3+,6-4+ |
| InChIKey | ZZBHLLFPRWNGAL-GGWOSOGESA-N |
| XLogP | 2.48 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|