C8H14F3N3 — CID 131701370
1-(3,5-dimethylpiperazin-1-yl)-2,2,2-trifluoroethanimine (PubChem CID 131701370) has the molecular formula C8H14F3N3 and a molecular weight of 209.21 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperazin-1-yl)-2,2,2-trifluoroethanimine.
| Compound Name | 1-(3,5-dimethylpiperazin-1-yl)-2,2,2-trifluoroethanimine |
|---|---|
| PubChem CID | 131701370 |
| Molecular Formula | C8H14F3N3 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 1-(3,5-dimethylpiperazin-1-yl)-2,2,2-trifluoroethanimine |
| SMILES | [H]/N=C(/N1CC(C)NC(C)C1)C(F)(F)F |
| InChI | InChI=1S/C8H14F3N3/c1-5-3-14(4-6(2)13-5)7(12)8(9,10)11/h5-6,12-13H,3-4H2,1-2H3/b12-7+ |
| InChIKey | AGDWXLMFJKFXKD-KPKJPENVSA-N |
| XLogP | 1.21 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|