C20H21N5O5 — CID 131702064
1-[1-[3-(1,3-benzodioxol-5-yl)-1H-pyrazole-5-carbonyl]piperidin-4-yl]-3-methylimidazolidine-2,4-dione (PubChem CID 131702064) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is 1-[1-[3-(1,3-benzodioxol-5-yl)-1H-pyrazole-5-carbonyl]piperidin-4-yl]-3-methylimidazolidine-2,4-dione.
| Compound Name | 1-[1-[3-(1,3-benzodioxol-5-yl)-1H-pyrazole-5-carbonyl]piperidin-4-yl]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 131702064 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-[1-[3-(1,3-benzodioxol-5-yl)-1H-pyrazole-5-carbonyl]piperidin-4-yl]-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)CN(C2CCN(C(=O)c3cc(-c4ccc5c(c4)OCO5)n[nH]3)CC2)C1=O |
| InChI | InChI=1S/C20H21N5O5/c1-23-18(26)10-25(20(23)28)13-4-6-24(7-5-13)19(27)15-9-14(21-22-15)12-2-3-16-17(8-12)30-11-29-16/h2-3,8-9,13H,4-7,10-11H2,1H3,(H,21,22) |
| InChIKey | WFNFRHFCQABBID-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|