C20H21NO4 — CID 131702564
N-[2,2-bis(furan-2-yl)ethyl]-2-(4-ethoxyphenyl)acetamide (PubChem CID 131702564) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-[2,2-bis(furan-2-yl)ethyl]-2-(4-ethoxyphenyl)acetamide.
| Compound Name | N-[2,2-bis(furan-2-yl)ethyl]-2-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 131702564 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-[2,2-bis(furan-2-yl)ethyl]-2-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(CC(=O)NCC(c2ccco2)c2ccco2)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-2-23-16-9-7-15(8-10-16)13-20(22)21-14-17(18-5-3-11-24-18)19-6-4-12-25-19/h3-12,17H,2,13-14H2,1H3,(H,21,22) |
| InChIKey | IQZIEKLJORQJDN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 64.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |