C6H10F2O4 — CID 131704200
(2R,3S,4S,5S)-5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 131704200) has the molecular formula C6H10F2O4 and a molecular weight of 184.14 g/mol. Its IUPAC name is (2R,3S,4S,5S)-5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3S,4S,5S)-5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 131704200 |
| Molecular Formula | C6H10F2O4 |
| Molecular Weight | 184.14 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | (2R,3S,4S,5S)-5,6-difluoro-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OC[C@H]1OC(F)[C@@H](F)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H10F2O4/c7-3-5(11)4(10)2(1-9)12-6(3)8/h2-6,9-11H,1H2/t2-,3+,4-,5-,6?/m1/s1 |
| InChIKey | YZRDPODBASCWCK-CBPJZXOFSA-N |
| XLogP | -1.27 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.14 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |