C24H31N5O3 — CID 131704352
(1R,3S,5R)-2-[2-(3-acetylpyrazolo[5,4-c]pyridin-1-yl)acetyl]-N-[(2,2-dimethylcyclopentyl)methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 131704352) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is (1R,3S,5R)-2-[2-(3-acetylpyrazolo[5,4-c]pyridin-1-yl)acetyl]-N-[(2,2-dimethylcyclopentyl)methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1R,3S,5R)-2-[2-(3-acetylpyrazolo[5,4-c]pyridin-1-yl)acetyl]-N-[(2,2-dimethylcyclopentyl)methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 131704352 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | (1R,3S,5R)-2-[2-(3-acetylpyrazolo[5,4-c]pyridin-1-yl)acetyl]-N-[(2,2-dimethylcyclopentyl)methyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | CC(=O)c1nn(CC(=O)N2[C@@H]3C[C@@H]3C[C@H]2C(=O)NCC2CCCC2(C)C)c2cnccc12 |
| InChI | InChI=1S/C24H31N5O3/c1-14(30)22-17-6-8-25-12-20(17)28(27-22)13-21(31)29-18-9-15(18)10-19(29)23(32)26-11-16-5-4-7-24(16,2)3/h6,8,12,15-16,18-19H,4-5,7,9-11,13H2,1-3H3,(H,26,32)/t15-,16?,18-,19+/m1/s1 |
| InChIKey | ZPIYVNGMWWIEIG-VBZNHOPUSA-N |
| XLogP | 2.57 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |