About N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide
N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide (PubChem CID 131707347) has the molecular formula C15H15N3O4S3
and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide |
| PubChem CID | 131707347 |
| Molecular Formula | C15H15N3O4S3 |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide |
| SMILES | Cn1c(=NN(S(C)(=O)=O)S(=O)(=O)c2ccccc2)sc2ccccc21 |
| InChI | InChI=1S/C15H15N3O4S3/c1-17-13-10-6-7-11-14(13)23-15(17)16-18(24(2,19)20)25(21,22)12-8-4-3-5-9-12/h3-11H,1-2H3 |
| InChIKey | SKYGHJNOPVVHJP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide?
The IUPAC name of N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide (CID 131707347) is N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide.
What is the SMILES notation for N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide?
The canonical SMILES for N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide is Cn1c(=NN(S(C)(=O)=O)S(=O)(=O)c2ccccc2)sc2ccccc21.
What is the InChIKey of N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide?
The InChIKey is SKYGHJNOPVVHJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O4S3/c1-17-13-10-6-7-11-14(13)23-15(17)16-18(24(2,19)20)25(21,22)12-8-4-3-5-9-12/h3-11H,1-2H3.
What are the key properties of N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide?
N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide has a molecular weight of 397.50 g/mol, XLogP of 1.71, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-methyl-1,3-benzothiazol-2-ylidene)amino]-N-methylsulfonylbenzenesulfonamide is sourced from PubChem (CID 131707347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).