C10H17N3O — CID 13170751
2,2,6-trimethyl-3,5,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 13170751) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 2,2,6-trimethyl-3,5,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2,2,6-trimethyl-3,5,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 13170751 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 2,2,6-trimethyl-3,5,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | CN1CCC2=C(C1)C(=O)NC(C)(C)N2 |
| InChI | InChI=1S/C10H17N3O/c1-10(2)11-8-4-5-13(3)6-7(8)9(14)12-10/h11H,4-6H2,1-3H3,(H,12,14) |
| InChIKey | OEZNIMGSJMODOE-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |