C18H28NO5- — CID 131708340
(2S,3S)-2-[[2-[(1R)-2-[(Z)-5-hydroxypent-2-enyl]-3-oxocyclopentyl]acetyl]amino]-3-methylpentanoate (PubChem CID 131708340) has the molecular formula C18H28NO5- and a molecular weight of 338.42 g/mol. Its IUPAC name is (2S,3S)-2-[[2-[(1R)-2-[(Z)-5-hydroxypent-2-enyl]-3-oxocyclopentyl]acetyl]amino]-3-methylpentanoate.
| Compound Name | (2S,3S)-2-[[2-[(1R)-2-[(Z)-5-hydroxypent-2-enyl]-3-oxocyclopentyl]acetyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 131708340 |
| Molecular Formula | C18H28NO5- |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (2S,3S)-2-[[2-[(1R)-2-[(Z)-5-hydroxypent-2-enyl]-3-oxocyclopentyl]acetyl]amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)C[C@H]1CCC(=O)C1C/C=C\CCO)C(=O)[O-] |
| InChI | InChI=1S/C18H29NO5/c1-3-12(2)17(18(23)24)19-16(22)11-13-8-9-15(21)14(13)7-5-4-6-10-20/h4-5,12-14,17,20H,3,6-11H2,1-2H3,(H,19,22)(H,23,24)/p-1/b5-4-/t12-,13+,14?,17-/m0/s1 |
| InChIKey | TXHIPUZLOILIIU-MJYWSMEFSA-M |
| XLogP | 0.58 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|