C21H29NO2 — CID 131708863
(8R,9S,10R,13S,14S,17R)-2,2,4,6,6,10,16,16-octadeuterio-13-ethyl-17-ethynyl-3-hydroxyimino-1,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 131708863) has the molecular formula C21H29NO2 and a molecular weight of 335.52 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-2,2,4,6,6,10,16,16-octadeuterio-13-ethyl-17-ethynyl-3-hydroxyimino-1,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,10R,13S,14S,17R)-2,2,4,6,6,10,16,16-octadeuterio-13-ethyl-17-ethynyl-3-hydroxyimino-1,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 131708863 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.27 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-2,2,4,6,6,10,16,16-octadeuterio-13-ethyl-17-ethynyl-3-hydroxyimino-1,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | [2H]C1=C2C([2H])([2H])C[C@H]3[C@@H]4CC([2H])([2H])[C@@](O)(C#C)[C@@]4(CC)CC[C@@H]3[C@@]2([2H])CC([2H])([2H])C1=NO |
| InChI | InChI=1S/C21H29NO2/c1-3-20-11-9-17-16-8-6-15(22-24)13-14(16)5-7-18(17)19(20)10-12-21(20,23)4-2/h2,13,16-19,23-24H,3,5-12H2,1H3/t16-,17+,18+,19-,20-,21-/m0/s1/i5D2,6D2,12D2,13D,16D |
| InChIKey | ISHXLNHNDMZNMC-AYDFAPMWSA-N |
| XLogP | 4.14 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|