C4H4ClNO4S — CID 131708991
5-chloro-6-methyl-2,2-dioxo(4,5,6-13C3)oxathiazin-4-one (PubChem CID 131708991) has the molecular formula C4H4ClNO4S and a molecular weight of 200.58 g/mol. Its IUPAC name is 5-chloro-6-methyl-2,2-dioxo(4,5,6-13C3)oxathiazin-4-one.
| Compound Name | 5-chloro-6-methyl-2,2-dioxo(4,5,6-13C3)oxathiazin-4-one |
|---|---|
| PubChem CID | 131708991 |
| Molecular Formula | C4H4ClNO4S |
| Molecular Weight | 200.58 g/mol |
| Exact Mass | 199.97 |
| IUPAC Name | 5-chloro-6-methyl-2,2-dioxo(4,5,6-13C3)oxathiazin-4-one |
| SMILES | C[13C]1=[13C](Cl)[13C](=O)NS(=O)(=O)O1 |
| InChI | InChI=1S/C4H4ClNO4S/c1-2-3(5)4(7)6-11(8,9)10-2/h1H3,(H,6,7)/i2+1,3+1,4+1 |
| InChIKey | YVZOKLTZSNJEQX-VWNJCJTFSA-N |
| XLogP | -0.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.58 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |