C21H32F2N6O — CID 131709778
6-fluoro-3-[6-[4-(2-fluoroethyl)piperazin-1-yl]pyrimidin-4-yl]-5-(1-methylcyclopropyl)oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole (PubChem CID 131709778) has the molecular formula C21H32F2N6O and a molecular weight of 422.52 g/mol. Its IUPAC name is 6-fluoro-3-[6-[4-(2-fluoroethyl)piperazin-1-yl]pyrimidin-4-yl]-5-(1-methylcyclopropyl)oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole.
| Compound Name | 6-fluoro-3-[6-[4-(2-fluoroethyl)piperazin-1-yl]pyrimidin-4-yl]-5-(1-methylcyclopropyl)oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole |
|---|---|
| PubChem CID | 131709778 |
| Molecular Formula | C21H32F2N6O |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 6-fluoro-3-[6-[4-(2-fluoroethyl)piperazin-1-yl]pyrimidin-4-yl]-5-(1-methylcyclopropyl)oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole |
| SMILES | CC1(OC2CC3C(CC2F)NNC3c2cc(N3CCN(CCF)CC3)ncn2)CC1 |
| InChI | InChI=1S/C21H32F2N6O/c1-21(2-3-21)30-18-10-14-16(11-15(18)23)26-27-20(14)17-12-19(25-13-24-17)29-8-6-28(5-4-22)7-9-29/h12-16,18,20,26-27H,2-11H2,1H3 |
| InChIKey | STYMGCPYSARTOL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |