C21H33N5O3 — CID 131709814
(2R)-4-[6-[5-(3-ethyloxetan-3-yl)oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]pyrimidin-4-yl]-2-methylmorpholine (PubChem CID 131709814) has the molecular formula C21H33N5O3 and a molecular weight of 403.53 g/mol. Its IUPAC name is (2R)-4-[6-[5-(3-ethyloxetan-3-yl)oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]pyrimidin-4-yl]-2-methylmorpholine.
| Compound Name | (2R)-4-[6-[5-(3-ethyloxetan-3-yl)oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]pyrimidin-4-yl]-2-methylmorpholine |
|---|---|
| PubChem CID | 131709814 |
| Molecular Formula | C21H33N5O3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | (2R)-4-[6-[5-(3-ethyloxetan-3-yl)oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]pyrimidin-4-yl]-2-methylmorpholine |
| SMILES | CCC1(OC2CCC3NNC(c4cc(N5CCO[C@H](C)C5)ncn4)C3C2)COC1 |
| InChI | InChI=1S/C21H33N5O3/c1-3-21(11-27-12-21)29-15-4-5-17-16(8-15)20(25-24-17)18-9-19(23-13-22-18)26-6-7-28-14(2)10-26/h9,13-17,20,24-25H,3-8,10-12H2,1-2H3/t14-,15?,16?,17?,20?/m1/s1 |
| InChIKey | BVNLPPZZPGCQML-ZIUDEIKKSA-N |
| XLogP | 1.58 |
| TPSA | 80.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |