About 6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene
6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene (PubChem CID 131710320) has the molecular formula C20H22O2
and a molecular weight of 294.39 g/mol. Its IUPAC name is 6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene.
Molecular Properties
| Compound Name | 6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene |
| PubChem CID | 131710320 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene |
| SMILES | C=CC1CC=CCC1.Cc1cc2c(cc1C)C(=O)C=CC2=O |
| InChI | InChI=1S/C12H10O2.C8H12/c1-7-5-9-10(6-8(7)2)12(14)4-3-11(9)13;1-2-8-6-4-3-5-7-8/h3-6H,1-2H3;2-4,8H,1,5-7H2 |
| InChIKey | JFJXTBIWVFNTAP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene?
The IUPAC name of 6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene (CID 131710320) is 6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene.
What is the SMILES notation for 6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene?
The canonical SMILES for 6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene is C=CC1CC=CCC1.Cc1cc2c(cc1C)C(=O)C=CC2=O.
What is the InChIKey of 6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene?
The InChIKey is JFJXTBIWVFNTAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.C8H12/c1-7-5-9-10(6-8(7)2)12(14)4-3-11(9)13;1-2-8-6-4-3-5-7-8/h3-6H,1-2H3;2-4,8H,1,5-7H2.
What are the key properties of 6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene?
6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene has a molecular weight of 294.39 g/mol, XLogP of 4.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethylnaphthalene-1,4-dione;4-ethenylcyclohexene is sourced from PubChem (CID 131710320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).