About 4-methyl-1,3-thiazole;thiophene-2-carboxylic acid
4-methyl-1,3-thiazole;thiophene-2-carboxylic acid (PubChem CID 131710490) has the molecular formula C9H9NO2S2
and a molecular weight of 227.31 g/mol. Its IUPAC name is 4-methyl-1,3-thiazole;thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-methyl-1,3-thiazole;thiophene-2-carboxylic acid |
| PubChem CID | 131710490 |
| Molecular Formula | C9H9NO2S2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 4-methyl-1,3-thiazole;thiophene-2-carboxylic acid |
| SMILES | Cc1cscn1.O=C(O)c1cccs1 |
| InChI | InChI=1S/C5H4O2S.C4H5NS/c6-5(7)4-2-1-3-8-4;1-4-2-6-3-5-4/h1-3H,(H,6,7);2-3H,1H3 |
| InChIKey | DSLMOMXOHIBFRW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-1,3-thiazole;thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-thiazole;thiophene-2-carboxylic acid?
The IUPAC name of 4-methyl-1,3-thiazole;thiophene-2-carboxylic acid (CID 131710490) is 4-methyl-1,3-thiazole;thiophene-2-carboxylic acid.
What is the SMILES notation for 4-methyl-1,3-thiazole;thiophene-2-carboxylic acid?
The canonical SMILES for 4-methyl-1,3-thiazole;thiophene-2-carboxylic acid is Cc1cscn1.O=C(O)c1cccs1.
What is the InChIKey of 4-methyl-1,3-thiazole;thiophene-2-carboxylic acid?
The InChIKey is DSLMOMXOHIBFRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O2S.C4H5NS/c6-5(7)4-2-1-3-8-4;1-4-2-6-3-5-4/h1-3H,(H,6,7);2-3H,1H3.
What are the key properties of 4-methyl-1,3-thiazole;thiophene-2-carboxylic acid?
4-methyl-1,3-thiazole;thiophene-2-carboxylic acid has a molecular weight of 227.31 g/mol, XLogP of 2.90, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-thiazole;thiophene-2-carboxylic acid is sourced from PubChem (CID 131710490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).