C31H41N3O6S — CID 131711638
(5R)-6-[[3-(3,4-dimethylphenoxy)-3-oxo-2-phenylpropanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;triethylazanium (PubChem CID 131711638) has the molecular formula C31H41N3O6S and a molecular weight of 583.75 g/mol. Its IUPAC name is (5R)-6-[[3-(3,4-dimethylphenoxy)-3-oxo-2-phenylpropanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;triethylazanium.
| Compound Name | (5R)-6-[[3-(3,4-dimethylphenoxy)-3-oxo-2-phenylpropanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;triethylazanium |
|---|---|
| PubChem CID | 131711638 |
| Molecular Formula | C31H41N3O6S |
| Molecular Weight | 583.75 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | (5R)-6-[[3-(3,4-dimethylphenoxy)-3-oxo-2-phenylpropanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;triethylazanium |
| SMILES | CC[NH+](CC)CC.Cc1ccc(OC(=O)C(C(=O)NC2C(=O)N3C(C(=O)[O-])C(C)(C)S[C@H]23)c2ccccc2)cc1C |
| InChI | InChI=1S/C25H26N2O6S.C6H15N/c1-13-10-11-16(12-14(13)2)33-24(32)17(15-8-6-5-7-9-15)20(28)26-18-21(29)27-19(23(30)31)25(3,4)34-22(18)27;1-4-7(5-2)6-3/h5-12,17-19,22H,1-4H3,(H,26,28)(H,30,31);4-6H2,1-3H3/t17?,18?,19?,22-;/m1./s1 |
| InChIKey | QMDHPGHXESJQOP-PTNLIECYSA-N |
| XLogP | 1.22 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.75 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|