C40H58O8S2Si — CID 131711718
[2-[9-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4,8-dimethyl-4-(methylsulfanylmethoxy)nonyl]-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 131711718) has the molecular formula C40H58O8S2Si and a molecular weight of 759.12 g/mol. Its IUPAC name is [2-[9-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4,8-dimethyl-4-(methylsulfanylmethoxy)nonyl]-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [2-[9-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4,8-dimethyl-4-(methylsulfanylmethoxy)nonyl]-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 131711718 |
| Molecular Formula | C40H58O8S2Si |
| Molecular Weight | 759.12 g/mol |
| Exact Mass | 758.33 |
| IUPAC Name | [2-[9-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4,8-dimethyl-4-(methylsulfanylmethoxy)nonyl]-1,3-dioxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CSCOC(C)(CCCC(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(O)CCC1(COS(=O)(=O)c2ccc(C)cc2)OCCO1 |
| InChI | InChI=1S/C40H58O8S2Si/c1-32-20-22-34(23-21-32)50(42,43)47-30-40(44-27-28-45-40)26-24-37(41)39(6,46-31-49-7)25-14-15-33(2)29-48-51(38(3,4)5,35-16-10-8-11-17-35)36-18-12-9-13-19-36/h8-13,16-23,33,37,41H,14-15,24-31H2,1-7H3 |
| InChIKey | UYMYYZKLTXYGGV-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.12 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|