About (2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine
(2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine (PubChem CID 131713003) has the molecular formula C15H27N3O4
and a molecular weight of 313.40 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine.
Molecular Properties
| Compound Name | (2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine |
| PubChem CID | 131713003 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine |
| SMILES | C1CCNC1.CC(C)C[C@H](NC(=O)[C@@H]1CCC(=O)N1)C(=O)O |
| InChI | InChI=1S/C11H18N2O4.C4H9N/c1-6(2)5-8(11(16)17)13-10(15)7-3-4-9(14)12-7;1-2-4-5-3-1/h6-8H,3-5H2,1-2H3,(H,12,14)(H,13,15)(H,16,17);5H,1-4H2/t7-,8-;/m0./s1 |
| InChIKey | JXSFKNQLFBAQAF-WSZWBAFRSA-N |
| XLogP | 0.25 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine?
The IUPAC name of (2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine (CID 131713003) is (2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine.
What is the SMILES notation for (2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine?
The canonical SMILES for (2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine is C1CCNC1.CC(C)C[C@H](NC(=O)[C@@H]1CCC(=O)N1)C(=O)O.
What is the InChIKey of (2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine?
The InChIKey is JXSFKNQLFBAQAF-WSZWBAFRSA-N. The full InChI is InChI=1S/C11H18N2O4.C4H9N/c1-6(2)5-8(11(16)17)13-10(15)7-3-4-9(14)12-7;1-2-4-5-3-1/h6-8H,3-5H2,1-2H3,(H,12,14)(H,13,15)(H,16,17);5H,1-4H2/t7-,8-;/m0./s1.
What are the key properties of (2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine?
(2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine has a molecular weight of 313.40 g/mol, XLogP of 0.25, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-methyl-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanoic acid;pyrrolidine is sourced from PubChem (CID 131713003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).