C22H27N5O6 — CID 131713010
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]purin-9-yl]oxolane-3,4-diol (PubChem CID 131713010) has the molecular formula C22H27N5O6 and a molecular weight of 457.49 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 131713010 |
| Molecular Formula | C22H27N5O6 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[6-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]purin-9-yl]oxolane-3,4-diol |
| SMILES | C=CCc1ccccc1OCC(O)CNc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H27N5O6/c1-2-5-13-6-3-4-7-15(13)32-10-14(29)8-23-20-17-21(25-11-24-20)27(12-26-17)22-19(31)18(30)16(9-28)33-22/h2-4,6-7,11-12,14,16,18-19,22,28-31H,1,5,8-10H2,(H,23,24,25)/t14?,16-,18-,19-,22-/m1/s1 |
| InChIKey | HLTDEPBWMPIOAY-SEQHXNGFSA-N |
| XLogP | 0.02 |
| TPSA | 155.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|