About 2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde
2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde (PubChem CID 131713932) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde |
| PubChem CID | 131713932 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde |
| SMILES | CC1(CC=O)C(O)=CC=CC1O |
| InChI | InChI=1S/C9H12O3/c1-9(5-6-10)7(11)3-2-4-8(9)12/h2-4,6-7,11-12H,5H2,1H3 |
| InChIKey | WCHYIRDDFLFASN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde?
The IUPAC name of 2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde (CID 131713932) is 2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde.
What is the SMILES notation for 2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde?
The canonical SMILES for 2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde is CC1(CC=O)C(O)=CC=CC1O.
What is the InChIKey of 2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde?
The InChIKey is WCHYIRDDFLFASN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-9(5-6-10)7(11)3-2-4-8(9)12/h2-4,6-7,11-12H,5H2,1H3.
What are the key properties of 2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde?
2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde has a molecular weight of 168.19 g/mol, XLogP of 0.95, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dihydroxy-1-methylcyclohexa-2,4-dien-1-yl)acetaldehyde is sourced from PubChem (CID 131713932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).