About O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate
O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate (PubChem CID 13171480) has the molecular formula C11H16N2OS
and a molecular weight of 224.33 g/mol. Its IUPAC name is O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate.
Molecular Properties
| Compound Name | O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate |
| PubChem CID | 13171480 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate |
| SMILES | CN(C)CCOC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C11H16N2OS/c1-13(2)8-9-14-11(15)12-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H,12,15) |
| InChIKey | YVHAYOPUPWBBPU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate?
The IUPAC name of O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate (CID 13171480) is O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate.
What is the SMILES notation for O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate?
The canonical SMILES for O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate is CN(C)CCOC(=S)Nc1ccccc1.
What is the InChIKey of O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate?
The InChIKey is YVHAYOPUPWBBPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2OS/c1-13(2)8-9-14-11(15)12-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H,12,15).
What are the key properties of O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate?
O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate has a molecular weight of 224.33 g/mol, XLogP of 1.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[2-(dimethylamino)ethyl] N-phenylcarbamothioate is sourced from PubChem (CID 13171480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).