C20H29ClN4O — CID 131716093
3-[(6aR,9S,10aR)-2-chloro-7-methyl-5,5a,6,6a,8,9,10,10a-octahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea (PubChem CID 131716093) has the molecular formula C20H29ClN4O and a molecular weight of 376.93 g/mol. Its IUPAC name is 3-[(6aR,9S,10aR)-2-chloro-7-methyl-5,5a,6,6a,8,9,10,10a-octahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea.
| Compound Name | 3-[(6aR,9S,10aR)-2-chloro-7-methyl-5,5a,6,6a,8,9,10,10a-octahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 131716093 |
| Molecular Formula | C20H29ClN4O |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 3-[(6aR,9S,10aR)-2-chloro-7-methyl-5,5a,6,6a,8,9,10,10a-octahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)N[C@H]1C[C@@H]2c3cc(Cl)cc4c3C(CN4)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C20H29ClN4O/c1-4-25(5-2)20(26)23-14-9-15-16-7-13(21)8-17-19(16)12(10-22-17)6-18(15)24(3)11-14/h7-8,12,14-15,18,22H,4-6,9-11H2,1-3H3,(H,23,26)/t12?,14-,15+,18+/m0/s1 |
| InChIKey | WNUFBLWWDLNLJL-UIRRPCRCSA-N |
| XLogP | 3.46 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |