C17H32N4O2 — CID 131716201
bis(1,3-diethylurea);toluene (PubChem CID 131716201) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is bis(1,3-diethylurea);toluene.
| Compound Name | bis(1,3-diethylurea);toluene |
|---|---|
| PubChem CID | 131716201 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | bis(1,3-diethylurea);toluene |
| SMILES | CCNC(=O)NCC.CCNC(=O)NCC.Cc1ccccc1 |
| InChI | InChI=1S/C7H8.2C5H12N2O/c1-7-5-3-2-4-6-7;2*1-3-6-5(8)7-4-2/h2-6H,1H3;2*3-4H2,1-2H3,(H2,6,7,8) |
| InChIKey | CJJZNVDPLSOOAH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |