C6H6N9O3-3 — CID 131716453
1,3,5-triazine-2,4,6-triamine triisocyanate (PubChem CID 131716453) has the molecular formula C6H6N9O3-3 and a molecular weight of 252.17 g/mol. Its IUPAC name is 1,3,5-triazine-2,4,6-triamine triisocyanate.
| Compound Name | 1,3,5-triazine-2,4,6-triamine triisocyanate |
|---|---|
| PubChem CID | 131716453 |
| Molecular Formula | C6H6N9O3-3 |
| Molecular Weight | 252.17 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 1,3,5-triazine-2,4,6-triamine triisocyanate |
| SMILES | Nc1nc(N)nc(N)n1.[N-]=C=O.[N-]=C=O.[N-]=C=O |
| InChI | InChI=1S/C3H6N6.3CNO/c4-1-7-2(5)9-3(6)8-1;3*2-1-3/h(H6,4,5,6,7,8,9);;;/q;3*-1 |
| InChIKey | MTBDJSPXHCOQKH-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 234.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.17 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|