C19H15BrClF7O2 — CID 131716895
trans-[4-(3-bromoprop-2-enyl)-2,3,5,6-tetrafluorophenyl]methyl (1S,3S)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 131716895) has the molecular formula C19H15BrClF7O2 and a molecular weight of 523.67 g/mol. Its IUPAC name is trans-[4-(3-bromoprop-2-enyl)-2,3,5,6-tetrafluorophenyl]methyl (1S,3S)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-[4-(3-bromoprop-2-enyl)-2,3,5,6-tetrafluorophenyl]methyl (1S,3S)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 131716895 |
| Molecular Formula | C19H15BrClF7O2 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 521.98 |
| IUPAC Name | trans-[4-(3-bromoprop-2-enyl)-2,3,5,6-tetrafluorophenyl]methyl (1S,3S)-3-[(Z)-2-chloro-3,3,3-trifluoroprop-1-enyl]-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](/C=C(\Cl)C(F)(F)F)[C@@H]1C(=O)OCc1c(F)c(F)c(CC=CBr)c(F)c1F |
| InChI | InChI=1S/C19H15BrClF7O2/c1-18(2)10(6-11(21)19(26,27)28)12(18)17(29)30-7-9-15(24)13(22)8(4-3-5-20)14(23)16(9)25/h3,5-6,10,12H,4,7H2,1-2H3/b5-3?,11-6-/t10-,12-/m1/s1 |
| InChIKey | IKWLCTOWBAVIDD-NVHIYUALSA-N |
| XLogP | 6.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|