About ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate
ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate (PubChem CID 131717522) has the molecular formula C20H19N3O2S
and a molecular weight of 365.46 g/mol. Its IUPAC name is ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate.
Molecular Properties
| Compound Name | ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate |
| PubChem CID | 131717522 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate |
| SMILES | CCOC(=O)Sc1ccc(-c2nc3n(c2-c2ccncc2)CCC3)cc1 |
| InChI | InChI=1S/C20H19N3O2S/c1-2-25-20(24)26-16-7-5-14(6-8-16)18-19(15-9-11-21-12-10-15)23-13-3-4-17(23)22-18/h5-12H,2-4,13H2,1H3 |
| InChIKey | BQFVZVNNAQVPFI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate?
The IUPAC name of ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate (CID 131717522) is ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate.
What is the SMILES notation for ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate?
The canonical SMILES for ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate is CCOC(=O)Sc1ccc(-c2nc3n(c2-c2ccncc2)CCC3)cc1.
What is the InChIKey of ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate?
The InChIKey is BQFVZVNNAQVPFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O2S/c1-2-25-20(24)26-16-7-5-14(6-8-16)18-19(15-9-11-21-12-10-15)23-13-3-4-17(23)22-18/h5-12H,2-4,13H2,1H3.
What are the key properties of ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate?
ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate has a molecular weight of 365.46 g/mol, XLogP of 4.81, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl [4-(3-pyridin-4-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-2-yl)phenyl]sulfanylformate is sourced from PubChem (CID 131717522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).