C27H32N2O6 — CID 131717763
benzyl (2R)-3-[1-(2-ethoxy-2-oxoethyl)indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 131717763) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is benzyl (2R)-3-[1-(2-ethoxy-2-oxoethyl)indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | benzyl (2R)-3-[1-(2-ethoxy-2-oxoethyl)indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 131717763 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | benzyl (2R)-3-[1-(2-ethoxy-2-oxoethyl)indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)Cn1cc(C[C@@H](NC(=O)OC(C)(C)C)C(=O)OCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C27H32N2O6/c1-5-33-24(30)17-29-16-20(21-13-9-10-14-23(21)29)15-22(28-26(32)35-27(2,3)4)25(31)34-18-19-11-7-6-8-12-19/h6-14,16,22H,5,15,17-18H2,1-4H3,(H,28,32)/t22-/m1/s1 |
| InChIKey | UYPUDNAULOEPPP-JOCHJYFZSA-N |
| XLogP | 4.38 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|