C28H50F2O4Si — CID 131718001
methyl (Z)-7-[(1R,2S,3R)-2-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate (PubChem CID 131718001) has the molecular formula C28H50F2O4Si and a molecular weight of 516.79 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S,3R)-2-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S,3R)-2-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 131718001 |
| Molecular Formula | C28H50F2O4Si |
| Molecular Weight | 516.79 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | methyl (Z)-7-[(1R,2S,3R)-2-[4-[tert-butyl(dimethyl)silyl]oxy-5,5-difluorooctyl]-3-methyl-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCC(F)(F)C(CCC[C@H]1[C@H](C)CC(=O)[C@@H]1C/C=C\CCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50F2O4Si/c1-9-19-28(29,30)25(34-35(7,8)27(3,4)5)17-14-16-22-21(2)20-24(31)23(22)15-12-10-11-13-18-26(32)33-6/h10,12,21-23,25H,9,11,13-20H2,1-8H3/b12-10-/t21-,22+,23-,25?/m1/s1 |
| InChIKey | CUCBOLQLZWNDHC-LJNZBSRASA-N |
| XLogP | 8.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.79 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|