C16H24O6 — CID 131718281
methyl (1S,4aS,7aS)-1-(1-ethoxyethoxy)-7-(methoxymethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 131718281) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is methyl (1S,4aS,7aS)-1-(1-ethoxyethoxy)-7-(methoxymethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1S,4aS,7aS)-1-(1-ethoxyethoxy)-7-(methoxymethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 131718281 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | methyl (1S,4aS,7aS)-1-(1-ethoxyethoxy)-7-(methoxymethyl)-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | CCOC(C)O[C@@H]1OC=C(C(=O)OC)[C@H]2CC=C(COC)[C@@H]12 |
| InChI | InChI=1S/C16H24O6/c1-5-20-10(2)22-16-14-11(8-18-3)6-7-12(14)13(9-21-16)15(17)19-4/h6,9-10,12,14,16H,5,7-8H2,1-4H3/t10?,12-,14-,16+/m1/s1 |
| InChIKey | QITLFICACSUTSY-UFHCQBPJSA-N |
| XLogP | 2.01 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|