About penta-1,4-dien-3-yl(silyloxy)silane;platinum
penta-1,4-dien-3-yl(silyloxy)silane;platinum (PubChem CID 131718370) has the molecular formula C5H12OPtSi2
and a molecular weight of 339.40 g/mol. Its IUPAC name is penta-1,4-dien-3-yl(silyloxy)silane;platinum.
Molecular Properties
| Compound Name | penta-1,4-dien-3-yl(silyloxy)silane;platinum |
| PubChem CID | 131718370 |
| Molecular Formula | C5H12OPtSi2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | penta-1,4-dien-3-yl(silyloxy)silane;platinum |
| SMILES | C=CC(C=C)[SiH2]O[SiH3].[Pt] |
| InChI | InChI=1S/C5H12OSi2.Pt/c1-3-5(4-2)8-6-7;/h3-5H,1-2,8H2,7H3; |
| InChIKey | ZWJMEGGJRYSELS-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze penta-1,4-dien-3-yl(silyloxy)silane;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of penta-1,4-dien-3-yl(silyloxy)silane;platinum?
The IUPAC name of penta-1,4-dien-3-yl(silyloxy)silane;platinum (CID 131718370) is penta-1,4-dien-3-yl(silyloxy)silane;platinum.
What is the SMILES notation for penta-1,4-dien-3-yl(silyloxy)silane;platinum?
The canonical SMILES for penta-1,4-dien-3-yl(silyloxy)silane;platinum is C=CC(C=C)[SiH2]O[SiH3].[Pt].
What is the InChIKey of penta-1,4-dien-3-yl(silyloxy)silane;platinum?
The InChIKey is ZWJMEGGJRYSELS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12OSi2.Pt/c1-3-5(4-2)8-6-7;/h3-5H,1-2,8H2,7H3;.
What are the key properties of penta-1,4-dien-3-yl(silyloxy)silane;platinum?
penta-1,4-dien-3-yl(silyloxy)silane;platinum has a molecular weight of 339.40 g/mol, XLogP of -0.47, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for penta-1,4-dien-3-yl(silyloxy)silane;platinum is sourced from PubChem (CID 131718370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).