C30H34N4 — CID 131718905
3-[3-(2,4-dimethylpentan-3-yl)aziridin-2-yl]-1-trityl-1,2,4-triazole (PubChem CID 131718905) has the molecular formula C30H34N4 and a molecular weight of 450.63 g/mol. Its IUPAC name is 3-[3-(2,4-dimethylpentan-3-yl)aziridin-2-yl]-1-trityl-1,2,4-triazole.
| Compound Name | 3-[3-(2,4-dimethylpentan-3-yl)aziridin-2-yl]-1-trityl-1,2,4-triazole |
|---|---|
| PubChem CID | 131718905 |
| Molecular Formula | C30H34N4 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 3-[3-(2,4-dimethylpentan-3-yl)aziridin-2-yl]-1-trityl-1,2,4-triazole |
| SMILES | CC(C)C(C(C)C)C1NC1c1ncn(C(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C30H34N4/c1-21(2)26(22(3)4)27-28(32-27)29-31-20-34(33-29)30(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h5-22,26-28,32H,1-4H3 |
| InChIKey | FGXAQCPEZTWRQT-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|