C14H26ClN3O3 — CID 131719164
3-[4-[4-(2-hydroxyethyl)piperidin-1-yl]butyl]imidazolidine-2,4-dione;hydrochloride (PubChem CID 131719164) has the molecular formula C14H26ClN3O3 and a molecular weight of 319.83 g/mol. Its IUPAC name is 3-[4-[4-(2-hydroxyethyl)piperidin-1-yl]butyl]imidazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-[4-[4-(2-hydroxyethyl)piperidin-1-yl]butyl]imidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 131719164 |
| Molecular Formula | C14H26ClN3O3 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 3-[4-[4-(2-hydroxyethyl)piperidin-1-yl]butyl]imidazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.O=C1CNC(=O)N1CCCCN1CCC(CCO)CC1 |
| InChI | InChI=1S/C14H25N3O3.ClH/c18-10-5-12-3-8-16(9-4-12)6-1-2-7-17-13(19)11-15-14(17)20;/h12,18H,1-11H2,(H,15,20);1H |
| InChIKey | IXYQZPGZNWXAFD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|