About 2-methylprop-2-en-1-ol;hydrate
2-methylprop-2-en-1-ol;hydrate (PubChem CID 131719387) has the molecular formula C4H10O2
and a molecular weight of 90.12 g/mol. Its IUPAC name is 2-methylprop-2-en-1-ol;hydrate.
Molecular Properties
| Compound Name | 2-methylprop-2-en-1-ol;hydrate |
| PubChem CID | 131719387 |
| Molecular Formula | C4H10O2 |
| Molecular Weight | 90.12 g/mol |
| Exact Mass | 90.07 |
| IUPAC Name | 2-methylprop-2-en-1-ol;hydrate |
| SMILES | C=C(C)CO.O |
| InChI | InChI=1S/C4H8O.H2O/c1-4(2)3-5;/h5H,1,3H2,2H3;1H2 |
| InChIKey | IVYQTTTWYUUNRJ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.12 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-en-1-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-en-1-ol;hydrate?
The IUPAC name of 2-methylprop-2-en-1-ol;hydrate (CID 131719387) is 2-methylprop-2-en-1-ol;hydrate.
What is the SMILES notation for 2-methylprop-2-en-1-ol;hydrate?
The canonical SMILES for 2-methylprop-2-en-1-ol;hydrate is C=C(C)CO.O.
What is the InChIKey of 2-methylprop-2-en-1-ol;hydrate?
The InChIKey is IVYQTTTWYUUNRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.H2O/c1-4(2)3-5;/h5H,1,3H2,2H3;1H2.
What are the key properties of 2-methylprop-2-en-1-ol;hydrate?
2-methylprop-2-en-1-ol;hydrate has a molecular weight of 90.12 g/mol, XLogP of -0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-en-1-ol;hydrate is sourced from PubChem (CID 131719387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).