C16H28OSi — CID 131719507
(1-tert-butyl-2,5,5-trimethyl-4-methylidene-3-prop-2-enylcyclopent-2-en-1-yl)oxysilane (PubChem CID 131719507) has the molecular formula C16H28OSi and a molecular weight of 264.48 g/mol. Its IUPAC name is (1-tert-butyl-2,5,5-trimethyl-4-methylidene-3-prop-2-enylcyclopent-2-en-1-yl)oxysilane.
| Compound Name | (1-tert-butyl-2,5,5-trimethyl-4-methylidene-3-prop-2-enylcyclopent-2-en-1-yl)oxysilane |
|---|---|
| PubChem CID | 131719507 |
| Molecular Formula | C16H28OSi |
| Molecular Weight | 264.48 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | (1-tert-butyl-2,5,5-trimethyl-4-methylidene-3-prop-2-enylcyclopent-2-en-1-yl)oxysilane |
| SMILES | C=CCC1=C(C)C(O[SiH3])(C(C)(C)C)C(C)(C)C1=C |
| InChI | InChI=1S/C16H28OSi/c1-9-10-13-11(2)15(7,8)16(17-18,12(13)3)14(4,5)6/h9H,1-2,10H2,3-8,18H3 |
| InChIKey | OWHLONHTKXEKFV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|