acetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate

C12H23NO5 — CID 131719663

IUPACacetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate
SMILESCC(=O)O.CCOC(=O)COCC1CCNCC1
InChIInChI=1S/C10H19NO3.C2H4O2/c1-2-14-10(12)8-13-7-9-3-5-11-6-4-9;1-2(3)4/h9,11H,2-8H2,1H3;1H3,(H,3,4)
InChIKeyRYYCFFJCLYKLLG-UHFFFAOYSA-N
MW261.32 g/mol
LogP0.66
Rot. Bonds5

About acetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate

acetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate (PubChem CID 131719663) has the molecular formula C12H23NO5 and a molecular weight of 261.32 g/mol. Its IUPAC name is acetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate.

Molecular Properties

Compound Nameacetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate
PubChem CID131719663
Molecular FormulaC12H23NO5
Molecular Weight261.32 g/mol
Exact Mass261.16
IUPAC Nameacetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate
SMILESCC(=O)O.CCOC(=O)COCC1CCNCC1
InChIInChI=1S/C10H19NO3.C2H4O2/c1-2-14-10(12)8-13-7-9-3-5-11-6-4-9;1-2(3)4/h9,11H,2-8H2,1H3;1H3,(H,3,4)
InChIKeyRYYCFFJCLYKLLG-UHFFFAOYSA-N
XLogP0.66
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.32
LogP ≤ 50.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze acetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate?
The IUPAC name of acetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate (CID 131719663) is acetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate.
What is the SMILES notation for acetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate?
The canonical SMILES for acetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate is CC(=O)O.CCOC(=O)COCC1CCNCC1.
What is the InChIKey of acetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate?
The InChIKey is RYYCFFJCLYKLLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3.C2H4O2/c1-2-14-10(12)8-13-7-9-3-5-11-6-4-9;1-2(3)4/h9,11H,2-8H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate?
acetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate has a molecular weight of 261.32 g/mol, XLogP of 0.66, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;ethyl 2-(piperidin-4-ylmethoxy)acetate is sourced from PubChem (CID 131719663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).