About ethyl 4-(ethylamino)butanoate
ethyl 4-(ethylamino)butanoate (PubChem CID 13171987) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is ethyl 4-(ethylamino)butanoate.
Molecular Properties
| Compound Name | ethyl 4-(ethylamino)butanoate |
| PubChem CID | 13171987 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | ethyl 4-(ethylamino)butanoate |
| SMILES | CCNCCCC(=O)OCC |
| InChI | InChI=1S/C8H17NO2/c1-3-9-7-5-6-8(10)11-4-2/h9H,3-7H2,1-2H3 |
| InChIKey | SZZGAYYWSNYVQI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(ethylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(ethylamino)butanoate?
The IUPAC name of ethyl 4-(ethylamino)butanoate (CID 13171987) is ethyl 4-(ethylamino)butanoate.
What is the SMILES notation for ethyl 4-(ethylamino)butanoate?
The canonical SMILES for ethyl 4-(ethylamino)butanoate is CCNCCCC(=O)OCC.
What is the InChIKey of ethyl 4-(ethylamino)butanoate?
The InChIKey is SZZGAYYWSNYVQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2/c1-3-9-7-5-6-8(10)11-4-2/h9H,3-7H2,1-2H3.
What are the key properties of ethyl 4-(ethylamino)butanoate?
ethyl 4-(ethylamino)butanoate has a molecular weight of 159.23 g/mol, XLogP of 0.94, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(ethylamino)butanoate is sourced from PubChem (CID 13171987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).