C8H14O5 — CID 131720023
(3R,4S,5R)-2-prop-2-enyloxane-2,3,4,5-tetrol (PubChem CID 131720023) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is (3R,4S,5R)-2-prop-2-enyloxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5R)-2-prop-2-enyloxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 131720023 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (3R,4S,5R)-2-prop-2-enyloxane-2,3,4,5-tetrol |
| SMILES | C=CCC1(O)OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H14O5/c1-2-3-8(12)7(11)6(10)5(9)4-13-8/h2,5-7,9-12H,1,3-4H2/t5-,6+,7-,8?/m1/s1 |
| InChIKey | YEOUULPKBYCLOM-MOMMNUENSA-N |
| XLogP | -1.64 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|