C30H16F6N2O6 — CID 131720099
4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione (PubChem CID 131720099) has the molecular formula C30H16F6N2O6 and a molecular weight of 614.45 g/mol. Its IUPAC name is 4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione.
| Compound Name | 4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 131720099 |
| Molecular Formula | C30H16F6N2O6 |
| Molecular Weight | 614.45 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | 4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline;5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione |
| SMILES | Nc1ccc(-c2ccc(N)cc2C(F)(F)F)c(C(F)(F)F)c1.O=C1OC(=O)c2cc(-c3ccc4c(c3)C(=O)OC4=O)ccc21 |
| InChI | InChI=1S/C16H6O6.C14H10F6N2/c17-13-9-3-1-7(5-11(9)15(19)21-13)8-2-4-10-12(6-8)16(20)22-14(10)18;15-13(16,17)11-5-7(21)1-3-9(11)10-4-2-8(22)6-12(10)14(18,19)20/h1-6H;1-6H,21-22H2 |
| InChIKey | GOQQQNYHGBXLOW-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.45 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|