About [(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid
[(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid (PubChem CID 131720170) has the molecular formula C22H22ClN5O3
and a molecular weight of 439.90 g/mol. Its IUPAC name is [(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid.
Molecular Properties
| Compound Name | [(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid |
| PubChem CID | 131720170 |
| Molecular Formula | C22H22ClN5O3 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | [(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid |
| SMILES | Cn1nnc2ccc(C(NN)c3ccc(Cl)cc3)cc21.O=C(O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C14H14ClN5.C8H8O3/c1-20-13-8-10(4-7-12(13)18-19-20)14(17-16)9-2-5-11(15)6-3-9;9-7(8(10)11)6-4-2-1-3-5-6/h2-8,14,17H,16H2,1H3;1-5,7,9H,(H,10,11)/t;7-/m.1/s1 |
| InChIKey | BPRWTWYZIHSSQE-HMZWWLAASA-N |
| XLogP | 2.98 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid?
The IUPAC name of [(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid (CID 131720170) is [(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid.
What is the SMILES notation for [(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid?
The canonical SMILES for [(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid is Cn1nnc2ccc(C(NN)c3ccc(Cl)cc3)cc21.O=C(O)[C@H](O)c1ccccc1.
What is the InChIKey of [(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid?
The InChIKey is BPRWTWYZIHSSQE-HMZWWLAASA-N. The full InChI is InChI=1S/C14H14ClN5.C8H8O3/c1-20-13-8-10(4-7-12(13)18-19-20)14(17-16)9-2-5-11(15)6-3-9;9-7(8(10)11)6-4-2-1-3-5-6/h2-8,14,17H,16H2,1H3;1-5,7,9H,(H,10,11)/t;7-/m.1/s1.
What are the key properties of [(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid?
[(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid has a molecular weight of 439.90 g/mol, XLogP of 2.98, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-chlorophenyl)-(3-methylbenzotriazol-5-yl)methyl]hydrazine;(2R)-2-hydroxy-2-phenylacetic acid is sourced from PubChem (CID 131720170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).