C22H25ClN2O3 — CID 131720189
(4-benzylpiperazin-1-yl)-(5-methoxy-2H-chromen-3-yl)methanone;hydrochloride (PubChem CID 131720189) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-(5-methoxy-2H-chromen-3-yl)methanone;hydrochloride.
| Compound Name | (4-benzylpiperazin-1-yl)-(5-methoxy-2H-chromen-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 131720189 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-(5-methoxy-2H-chromen-3-yl)methanone;hydrochloride |
| SMILES | COc1cccc2c1C=C(C(=O)N1CCN(Cc3ccccc3)CC1)CO2.Cl |
| InChI | InChI=1S/C22H24N2O3.ClH/c1-26-20-8-5-9-21-19(20)14-18(16-27-21)22(25)24-12-10-23(11-13-24)15-17-6-3-2-4-7-17;/h2-9,14H,10-13,15-16H2,1H3;1H |
| InChIKey | DBPBNDDIVOFEPE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |